C20H28O5 — CID 162981767
(5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl) 3-methylbutanoate (PubChem CID 162981767) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl) 3-methylbutanoate.
| Compound Name | (5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 162981767 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (5,9,14-trimethyl-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl) 3-methylbutanoate |
| SMILES | CC1=C2CC3OC3(C)C2C2OC(=O)C(C)C2C(OC(=O)CC(C)C)C1 |
| InChI | InChI=1S/C20H28O5/c1-9(2)6-15(21)23-13-7-10(3)12-8-14-20(5,25-14)17(12)18-16(13)11(4)19(22)24-18/h9,11,13-14,16-18H,6-8H2,1-5H3 |
| InChIKey | DFAANSZXNZEUGY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|