C15H26O3 — CID 162982466
4-[(1R,2S)-2-[(3S)-3-hydroxybutyl]-3,3-dimethylcyclobutyl]pent-4-enoic acid (PubChem CID 162982466) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-[(1R,2S)-2-[(3S)-3-hydroxybutyl]-3,3-dimethylcyclobutyl]pent-4-enoic acid.
| Compound Name | 4-[(1R,2S)-2-[(3S)-3-hydroxybutyl]-3,3-dimethylcyclobutyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 162982466 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4-[(1R,2S)-2-[(3S)-3-hydroxybutyl]-3,3-dimethylcyclobutyl]pent-4-enoic acid |
| SMILES | C=C(CCC(=O)O)[C@@H]1CC(C)(C)[C@H]1CC[C@H](C)O |
| InChI | InChI=1S/C15H26O3/c1-10(5-8-14(17)18)12-9-15(3,4)13(12)7-6-11(2)16/h11-13,16H,1,5-9H2,2-4H3,(H,17,18)/t11-,12-,13-/m0/s1 |
| InChIKey | RFRFRFCFKSGCHT-AVGNSLFASA-N |
| XLogP | 3.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|