C21H33NO — CID 77014335
(2E)-6-[(1R,2R)-3,3-dimethyl-2-(3-methylbut-3-enyl)cyclobutyl]-N-prop-2-enylhepta-2,6-dienamide (PubChem CID 77014335) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (2E)-6-[(1R,2R)-3,3-dimethyl-2-(3-methylbut-3-enyl)cyclobutyl]-N-prop-2-enylhepta-2,6-dienamide.
| Compound Name | (2E)-6-[(1R,2R)-3,3-dimethyl-2-(3-methylbut-3-enyl)cyclobutyl]-N-prop-2-enylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 77014335 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (2E)-6-[(1R,2R)-3,3-dimethyl-2-(3-methylbut-3-enyl)cyclobutyl]-N-prop-2-enylhepta-2,6-dienamide |
| SMILES | C=CCNC(=O)/C=C/CCC(=C)[C@@H]1CC(C)(C)[C@@H]1CCC(=C)C |
| InChI | InChI=1S/C21H33NO/c1-7-14-22-20(23)11-9-8-10-17(4)18-15-21(5,6)19(18)13-12-16(2)3/h7,9,11,18-19H,1-2,4,8,10,12-15H2,3,5-6H3,(H,22,23)/b11-9+/t18-,19+/m0/s1 |
| InChIKey | HCJKJGVLSCAUCC-AYLUNBTKSA-N |
| XLogP | 5.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|