About 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid
2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid (PubChem CID 163093953) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid.
Analyze 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid?
The IUPAC name of 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid (CID 163093953) is 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid.
What is the SMILES notation for 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid?
The canonical SMILES for 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid is CC1CC(O)CC(C)(C)C1CCC(O)C(=O)O.
What is the InChIKey of 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid?
The InChIKey is HJEKFWBWYCIINK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-8-6-9(14)7-13(2,3)10(8)4-5-11(15)12(16)17/h8-11,14-15H,4-7H2,1-3H3,(H,16,17).
What are the key properties of 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid?
2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid has a molecular weight of 244.33 g/mol, XLogP of 1.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-(4-hydroxy-2,2,6-trimethylcyclohexyl)butanoic acid is sourced from PubChem (CID 163093953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).