C40H76O2 — CID 172991149
(1R,4R,5S)-4-[(E,3R,7R,12R,16R)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-17-enyl]-3,3,5-trimethylcyclohexan-1-ol (PubChem CID 172991149) has the molecular formula C40H76O2 and a molecular weight of 589.05 g/mol. Its IUPAC name is (1R,4R,5S)-4-[(E,3R,7R,12R,16R)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-17-enyl]-3,3,5-trimethylcyclohexan-1-ol.
| Compound Name | (1R,4R,5S)-4-[(E,3R,7R,12R,16R)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-17-enyl]-3,3,5-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 172991149 |
| Molecular Formula | C40H76O2 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.58 |
| IUPAC Name | (1R,4R,5S)-4-[(E,3R,7R,12R,16R)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadec-17-enyl]-3,3,5-trimethylcyclohexan-1-ol |
| SMILES | C[C@H](CCCC[C@@H](C)CCC[C@@H](C)/C=C/[C@@H]1[C@@H](C)C[C@@H](O)CC1(C)C)CCC[C@@H](C)CC[C@@H]1[C@@H](C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C40H76O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h21,23,29-38,41-42H,11-20,22,24-28H2,1-10H3/b23-21+/t29-,30-,31-,32-,33+,34+,35-,36-,37-,38-/m1/s1 |
| InChIKey | RQMQOLKJMZEWSM-GOWLFZHNSA-N |
| XLogP | 11.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|