C40H72O2 — CID 172991151
(1R)-4-[(1E,3R,7S,12S,16R,17E)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadeca-1,17-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 172991151) has the molecular formula C40H72O2 and a molecular weight of 585.01 g/mol. Its IUPAC name is (1R)-4-[(1E,3R,7S,12S,16R,17E)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadeca-1,17-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1R)-4-[(1E,3R,7S,12S,16R,17E)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadeca-1,17-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 172991151 |
| Molecular Formula | C40H72O2 |
| Molecular Weight | 585.01 g/mol |
| Exact Mass | 584.55 |
| IUPAC Name | (1R)-4-[(1E,3R,7S,12S,16R,17E)-18-[(1S,4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexyl]-3,7,12,16-tetramethyloctadeca-1,17-dienyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(/C=C/[C@H](C)CCC[C@@H](C)CCCC[C@H](C)CCC[C@@H](C)/C=C/[C@@H]2[C@@H](C)C[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H72O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h21-24,29-33,35-37,41-42H,11-20,25-28H2,1-10H3/b23-21+,24-22+/t29-,30-,31+,32+,33-,35+,36+,37+/m0/s1 |
| InChIKey | NMGNFQDJUZIVRB-PAWZZTJRSA-N |
| XLogP | 11.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.01 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|