C40H70O3 — CID 176508690
(1R,3S,6S)-6-[18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadec-17-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol (PubChem CID 176508690) has the molecular formula C40H70O3 and a molecular weight of 599.00 g/mol. Its IUPAC name is (1R,3S,6S)-6-[18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadec-17-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1R,3S,6S)-6-[18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadec-17-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 176508690 |
| Molecular Formula | C40H70O3 |
| Molecular Weight | 599.00 g/mol |
| Exact Mass | 598.53 |
| IUPAC Name | (1R,3S,6S)-6-[18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadec-17-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol |
| SMILES | CC1=C(C#CC(C)CCCC(C)CCCCC(C)CCCC(C)CC[C@@]23O[C@]2(C)C[C@@H](O)CC3(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H70O3/c1-29(17-13-19-31(3)21-22-36-33(5)25-34(41)26-37(36,6)7)15-11-12-16-30(2)18-14-20-32(4)23-24-40-38(8,9)27-35(42)28-39(40,10)43-40/h29-32,34-35,41-42H,11-20,23-28H2,1-10H3/t29?,30?,31?,32?,34-,35+,39-,40+/m1/s1 |
| InChIKey | LDENBDHCAFICSM-SKLNGKRZSA-N |
| XLogP | 10.42 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.00 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|