C30H46O2 — CID 42627189
(1R)-4-[(1E,3E,5E,11Z,13E,15E)-17-hydroxy-3,7,12,16-tetramethylheptadeca-1,3,5,11,13,15-hexaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 42627189) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is (1R)-4-[(1E,3E,5E,11Z,13E,15E)-17-hydroxy-3,7,12,16-tetramethylheptadeca-1,3,5,11,13,15-hexaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1R)-4-[(1E,3E,5E,11Z,13E,15E)-17-hydroxy-3,7,12,16-tetramethylheptadeca-1,3,5,11,13,15-hexaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 42627189 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (1R)-4-[(1E,3E,5E,11Z,13E,15E)-17-hydroxy-3,7,12,16-tetramethylheptadeca-1,3,5,11,13,15-hexaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)CCC/C=C(C)\C=C\C=C(/C)CO)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C30H46O2/c1-23(12-8-9-13-24(2)15-11-17-26(4)22-31)14-10-16-25(3)18-19-29-27(5)20-28(32)21-30(29,6)7/h10-11,13-19,23,28,31-32H,8-9,12,20-22H2,1-7H3/b14-10+,15-11+,19-18+,24-13-,25-16+,26-17+/t23?,28-/m1/s1 |
| InChIKey | XUYNHKMBWOPRFS-RRIKJMKXSA-N |
| XLogP | 7.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|