C40H64O — CID 171662171
(1R)-3,5,5-trimethyl-4-[(1E,8E,10E,13E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,8,10,13,17-pentaenyl]cyclohex-3-en-1-ol (PubChem CID 171662171) has the molecular formula C40H64O and a molecular weight of 560.95 g/mol. Its IUPAC name is (1R)-3,5,5-trimethyl-4-[(1E,8E,10E,13E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,8,10,13,17-pentaenyl]cyclohex-3-en-1-ol.
| Compound Name | (1R)-3,5,5-trimethyl-4-[(1E,8E,10E,13E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,8,10,13,17-pentaenyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 171662171 |
| Molecular Formula | C40H64O |
| Molecular Weight | 560.95 g/mol |
| Exact Mass | 560.50 |
| IUPAC Name | (1R)-3,5,5-trimethyl-4-[(1E,8E,10E,13E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,8,10,13,17-pentaenyl]cyclohex-3-en-1-ol |
| SMILES | CC1=C(/C=C/C(C)C/C=C/C(C)/C=C/C=C/C(C)CCCC(C)/C=C/C2=C(C)C[C@@H](O)CC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H64O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-13,16-18,23-26,30-33,36,41H,14-15,19-22,27-29H2,1-10H3/b16-11+,17-12+,18-13+,25-23+,26-24+/t30?,31?,32?,33?,36-/m1/s1 |
| InChIKey | SCGNNBXVEMDLGL-COAWVHEXSA-N |
| XLogP | 11.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.95 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|