C32H50O3 — CID 171118790
(10Z,12E,14E,16E,18E)-11-hydroxy-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13,17-tetramethylnonadeca-10,12,14,16,18-pentaen-2-one (PubChem CID 171118790) has the molecular formula C32H50O3 and a molecular weight of 482.75 g/mol. Its IUPAC name is (10Z,12E,14E,16E,18E)-11-hydroxy-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13,17-tetramethylnonadeca-10,12,14,16,18-pentaen-2-one.
| Compound Name | (10Z,12E,14E,16E,18E)-11-hydroxy-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13,17-tetramethylnonadeca-10,12,14,16,18-pentaen-2-one |
|---|---|
| PubChem CID | 171118790 |
| Molecular Formula | C32H50O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | (10Z,12E,14E,16E,18E)-11-hydroxy-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13,17-tetramethylnonadeca-10,12,14,16,18-pentaen-2-one |
| SMILES | CC(=O)CC(C)CCCC(C)C/C=C(O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C32H50O3/c1-23(11-9-13-25(3)19-28(6)33)15-17-29(34)20-26(4)14-10-12-24(2)16-18-31-27(5)21-30(35)22-32(31,7)8/h10,12,14,16-18,20,23,25,30,34-35H,9,11,13,15,19,21-22H2,1-8H3/b14-10+,18-16+,24-12+,26-20+,29-17- |
| InChIKey | LNIILLHDKYNMFR-AQGLYHNRSA-N |
| XLogP | 8.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|