C28H24N2O6S — CID 162989191
6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-(1,3-thiazol-2-yl)phenyl]methylamino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 162989191) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-(1,3-thiazol-2-yl)phenyl]methylamino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-(1,3-thiazol-2-yl)phenyl]methylamino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 162989191 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-(1,3-thiazol-2-yl)phenyl]methylamino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCc3ccc(-c4nccs4)cc3)C(=O)C12C |
| InChI | InChI=1S/C28H24N2O6S/c1-13-23(33)21(15(3)31)25-22(24(13)34)28(4)19(36-25)11-18(32)20(26(28)35)14(2)30-12-16-5-7-17(8-6-16)27-29-9-10-37-27/h5-11,30,33-34H,12H2,1-4H3 |
| InChIKey | CXVYQXIMBUELLR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|