C19H18O7 — CID 163192818
6-acetyl-7,9-dihydroxy-2-(1-methoxyethylidene)-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 163192818) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is 6-acetyl-7,9-dihydroxy-2-(1-methoxyethylidene)-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-7,9-dihydroxy-2-(1-methoxyethylidene)-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 163192818 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-acetyl-7,9-dihydroxy-2-(1-methoxyethylidene)-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COC(C)=C1C(=O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3C2(C)C1=O |
| InChI | InChI=1S/C19H18O7/c1-7-15(22)12(8(2)20)17-14(16(7)23)19(4)11(26-17)6-10(21)13(18(19)24)9(3)25-5/h6,22-23H,1-5H3 |
| InChIKey | OGFPHLZRJFTSOE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|