C23H25NO8 — CID 124878785
5-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]pentanoic acid (PubChem CID 124878785) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is 5-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]pentanoic acid.
| Compound Name | 5-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 124878785 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 5-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]pentanoic acid |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCCCC(=O)O)C(=O)[C@@]12C |
| InChI | InChI=1S/C23H25NO8/c1-10-19(29)17(12(3)25)21-18(20(10)30)23(4)14(32-21)9-13(26)16(22(23)31)11(2)24-8-6-5-7-15(27)28/h9,24,29-30H,5-8H2,1-4H3,(H,27,28)/b16-11+/t23-/m0/s1 |
| InChIKey | NDECAKZQMZKBRI-LJJIPZOBSA-N |
| XLogP | 2.41 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|