C26H28N4O8 — CID 110207285
3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]propanamide (PubChem CID 110207285) has the molecular formula C26H28N4O8 and a molecular weight of 524.53 g/mol. Its IUPAC name is 3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]propanamide.
| Compound Name | 3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 110207285 |
| Molecular Formula | C26H28N4O8 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]propanamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCC(=O)NCCc3nc(C)no3)C(=O)[C@@]12C |
| InChI | InChI=1S/C26H28N4O8/c1-11-22(34)20(13(3)31)24-21(23(11)35)26(5)16(37-24)10-15(32)19(25(26)36)12(2)27-8-6-17(33)28-9-7-18-29-14(4)30-38-18/h10,27,34-35H,6-9H2,1-5H3,(H,28,33)/b19-12+/t26-/m0/s1 |
| InChIKey | SBGLENZHMVQDAP-CTSWPSOHSA-N |
| XLogP | 1.60 |
| TPSA | 180.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|