C28H32N4O8 — CID 171135449
3-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]propanamide (PubChem CID 171135449) has the molecular formula C28H32N4O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is 3-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]propanamide.
| Compound Name | 3-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 171135449 |
| Molecular Formula | C28H32N4O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 3-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-N-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]propanamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCC(=O)NCCc3nc(C(C)C)no3)C(=O)[C@@]12C |
| InChI | InChI=1S/C28H32N4O8/c1-12(2)27-31-19(40-32-27)8-10-30-18(35)7-9-29-14(4)20-16(34)11-17-28(6,26(20)38)22-24(37)13(3)23(36)21(15(5)33)25(22)39-17/h11-12,29,36-37H,7-10H2,1-6H3,(H,30,35)/t28-/m0/s1 |
| InChIKey | KUDUOTDARSYWIE-NDEPHWFRSA-N |
| XLogP | 2.41 |
| TPSA | 180.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|