C25H25N3O7S — CID 110206471
3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 110206471) has the molecular formula C25H25N3O7S and a molecular weight of 511.56 g/mol. Its IUPAC name is 3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 110206471 |
| Molecular Formula | C25H25N3O7S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 3-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCC(=O)Nc3nc(C)cs3)C(=O)[C@@]12C |
| InChI | InChI=1S/C25H25N3O7S/c1-10-9-36-24(27-10)28-16(31)6-7-26-12(3)17-14(30)8-15-25(5,23(17)34)19-21(33)11(2)20(32)18(13(4)29)22(19)35-15/h8-9,26,32-33H,6-7H2,1-5H3,(H,27,28,31)/b17-12+/t25-/m0/s1 |
| InChIKey | QALPSDCFRWMVHS-GCTXXEFPSA-N |
| XLogP | 2.95 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|