C27H27NO8 — CID 171135389
(9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-methoxyphenoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 171135389) has the molecular formula C27H27NO8 and a molecular weight of 493.51 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-methoxyphenoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-methoxyphenoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135389 |
| Molecular Formula | C27H27NO8 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-methoxyphenoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccccc1OCCNC(C)=C1C(=O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3[C@@]2(C)C1=O |
| InChI | InChI=1S/C27H27NO8/c1-13-23(31)21(15(3)29)25-22(24(13)32)27(4)19(36-25)12-16(30)20(26(27)33)14(2)28-10-11-35-18-9-7-6-8-17(18)34-5/h6-9,12,28,31-32H,10-11H2,1-5H3/t27-/m0/s1 |
| InChIKey | WPJUCSUJHCXPDD-MHZLTWQESA-N |
| XLogP | 3.25 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|