C30H33NO8 — CID 125122098
(2E,9bR)-6-acetyl-2-[1-[[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 125122098) has the molecular formula C30H33NO8 and a molecular weight of 535.59 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-2-[1-[[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-2-[1-[[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 125122098 |
| Molecular Formula | C30H33NO8 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (2E,9bR)-6-acetyl-2-[1-[[(1S)-1-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccc([C@@H](N/C(C)=C2\C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4[C@@]3(C)C2=O)C(C)C)cc1OC |
| InChI | InChI=1S/C30H33NO8/c1-13(2)25(17-9-10-19(37-7)20(11-17)38-8)31-15(4)22-18(33)12-21-30(6,29(22)36)24-27(35)14(3)26(34)23(16(5)32)28(24)39-21/h9-13,25,31,34-35H,1-8H3/b22-15+/t25-,30-/m0/s1 |
| InChIKey | DHCNRKGBDYGVMF-KAGFHXPLSA-N |
| XLogP | 4.57 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|