C36H32CuO14 — CID 71300508
copper;bis(2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one) (PubChem CID 71300508) has the molecular formula C36H32CuO14 and a molecular weight of 752.18 g/mol. Its IUPAC name is copper;bis(2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one).
| Compound Name | copper;bis(2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one) |
|---|---|
| PubChem CID | 71300508 |
| Molecular Formula | C36H32CuO14 |
| Molecular Weight | 752.18 g/mol |
| Exact Mass | 751.11 |
| IUPAC Name | copper;bis(2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one) |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3C2(C)C1=O.CC(=O)C1=C(O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3C2(C)C1=O.[Cu] |
| InChI | InChI=1S/2C18H16O7.Cu/c2*1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24;/h2*5,21-23H,1-4H3; |
| InChIKey | BTVYZMGEOXXCMC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|