C24H22N2O6 — CID 10788945
(9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-(2-phenylhydrazinyl)dibenzofuran-3-one (PubChem CID 10788945) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-(2-phenylhydrazinyl)dibenzofuran-3-one.
| Compound Name | (9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-(2-phenylhydrazinyl)dibenzofuran-3-one |
|---|---|
| PubChem CID | 10788945 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-(2-phenylhydrazinyl)dibenzofuran-3-one |
| SMILES | CC(=O)C1=C(NNc2ccccc2)[C@]2(C)C(=CC1=O)Oc1c(C(C)=O)c(O)c(C)c(O)c12 |
| InChI | InChI=1S/C24H22N2O6/c1-11-20(30)18(13(3)28)22-19(21(11)31)24(4)16(32-22)10-15(29)17(12(2)27)23(24)26-25-14-8-6-5-7-9-14/h5-10,25-26,30-31H,1-4H3/t24-/m1/s1 |
| InChIKey | BXDSZDQLOHDPCF-XMMPIXPASA-N |
| XLogP | 3.19 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|