C18H16NaO7 — CID 87964517
Usnicacidsodium (PubChem CID 87964517) has the molecular formula C18H16NaO7 and a molecular weight of 367.31 g/mol.
| Compound Name | Usnicacidsodium |
|---|---|
| PubChem CID | 87964517 |
| Molecular Formula | C18H16NaO7 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(C(C)=O)C(=O)C12C.[Na] |
| InChI | InChI=1S/C18H16O7.Na/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24;/h5,11,22-23H,1-4H3; |
| InChIKey | YGZOLUSJFYDOMD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|