C20H21NO6S — CID 123157720
6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[C-methyl-N-(2-sulfanylethyl)carbonimidoyl]dibenzofuran-1,3-dione (PubChem CID 123157720) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[C-methyl-N-(2-sulfanylethyl)carbonimidoyl]dibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[C-methyl-N-(2-sulfanylethyl)carbonimidoyl]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 123157720 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[C-methyl-N-(2-sulfanylethyl)carbonimidoyl]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(/C(C)=N/CCS)C(=O)C12C |
| InChI | InChI=1S/C20H21NO6S/c1-8-16(24)14(10(3)22)18-15(17(8)25)20(4)12(27-18)7-11(23)13(19(20)26)9(2)21-5-6-28/h7,13,24-25,28H,5-6H2,1-4H3/b21-9+ |
| InChIKey | OUDYVYRIMUGMBU-ZVBGSRNCSA-N |
| XLogP | 2.30 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|