C24H21N3O7 — CID 11431186
N-[(E)-1-[(9bS)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-yl]ethylideneamino]pyridine-4-carboxamide (PubChem CID 11431186) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is N-[(E)-1-[(9bS)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-yl]ethylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-1-[(9bS)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-yl]ethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11431186 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[(E)-1-[(9bS)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-yl]ethylideneamino]pyridine-4-carboxamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(/C(C)=N/NC(=O)c3ccncc3)C(=O)[C@]12C |
| InChI | InChI=1S/C24H21N3O7/c1-10-19(30)17(12(3)28)21-18(20(10)31)24(4)15(34-21)9-14(29)16(22(24)32)11(2)26-27-23(33)13-5-7-25-8-6-13/h5-9,16,30-31H,1-4H3,(H,27,33)/b26-11+/t16?,24-/m1/s1 |
| InChIKey | IQSJETZXLHBHQX-DPWZCEMTSA-N |
| XLogP | 2.11 |
| TPSA | 155.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|