C25H23NO9 — CID 163090684
methyl 5-[[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]methyl]furan-2-carboxylate (PubChem CID 163090684) has the molecular formula C25H23NO9 and a molecular weight of 481.46 g/mol. Its IUPAC name is methyl 5-[[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 163090684 |
| Molecular Formula | C25H23NO9 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | methyl 5-[[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(C)=C2C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4C3(C)C2=O)o1 |
| InChI | InChI=1S/C25H23NO9/c1-10-20(29)18(12(3)27)22-19(21(10)30)25(4)16(35-22)8-14(28)17(23(25)31)11(2)26-9-13-6-7-15(34-13)24(32)33-5/h6-8,26,29-30H,9H2,1-5H3 |
| InChIKey | GGXMFGFDSUPNSU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|