C23H24N2O10 — CID 163090703
2-[[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 163090703) has the molecular formula C23H24N2O10 and a molecular weight of 488.45 g/mol. Its IUPAC name is 2-[[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 163090703 |
| Molecular Formula | C23H24N2O10 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCC(=O)NC(CO)C(=O)O)C(=O)C12C |
| InChI | InChI=1S/C23H24N2O10/c1-8-18(30)16(10(3)27)20-17(19(8)31)23(4)13(35-20)5-12(28)15(21(23)32)9(2)24-6-14(29)25-11(7-26)22(33)34/h5,11,24,26,30-31H,6-7H2,1-4H3,(H,25,29)(H,33,34) |
| InChIKey | RXNBWQWKZWVXBX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|