C28H26N2O9 — CID 110208205
2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide (PubChem CID 110208205) has the molecular formula C28H26N2O9 and a molecular weight of 534.52 g/mol. Its IUPAC name is 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide.
| Compound Name | 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 110208205 |
| Molecular Formula | C28H26N2O9 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCC(=O)NCc3ccc4c(c3)OCO4)C(=O)[C@@]12C |
| InChI | InChI=1S/C28H26N2O9/c1-12-24(34)22(14(3)31)26-23(25(12)35)28(4)19(39-26)8-16(32)21(27(28)36)13(2)29-10-20(33)30-9-15-5-6-17-18(7-15)38-11-37-17/h5-8,29,34-35H,9-11H2,1-4H3,(H,30,33)/b21-13+/t28-/m0/s1 |
| InChIKey | RKOAFELVESRKPR-PPOGSYTESA-N |
| XLogP | 2.20 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|