C22H25NO8 — CID 110207677
(2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-hydroxyethoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 110207677) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-hydroxyethoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-hydroxyethoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 110207677 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(2-hydroxyethoxy)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCOCCO)C(=O)[C@@]12C |
| InChI | InChI=1S/C22H25NO8/c1-10-18(27)16(12(3)25)20-17(19(10)28)22(4)14(31-20)9-13(26)15(21(22)29)11(2)23-5-7-30-8-6-24/h9,23-24,27-28H,5-8H2,1-4H3/b15-11+/t22-/m0/s1 |
| InChIKey | RWSXYEFZKRKYSB-QMUTUGEISA-N |
| XLogP | 1.17 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|