C26H25NO7 — CID 110206286
(2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(4-hydroxyphenyl)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 110206286) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(4-hydroxyphenyl)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(4-hydroxyphenyl)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 110206286 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-(4-hydroxyphenyl)ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCc3ccc(O)cc3)C(=O)[C@@]12C |
| InChI | InChI=1S/C26H25NO7/c1-12-22(31)20(14(3)28)24-21(23(12)32)26(4)18(34-24)11-17(30)19(25(26)33)13(2)27-10-9-15-5-7-16(29)8-6-15/h5-8,11,27,29,31-32H,9-10H2,1-4H3/b19-13+/t26-/m0/s1 |
| InChIKey | MXAAUSMZBGOPAU-WGKDYUSESA-N |
| XLogP | 3.11 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|