C28H29NO8 — CID 110207391
(2E)-6-acetyl-2-[1-[2-(3,4-dimethoxyphenyl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 110207391) has the molecular formula C28H29NO8 and a molecular weight of 507.54 g/mol. Its IUPAC name is (2E)-6-acetyl-2-[1-[2-(3,4-dimethoxyphenyl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E)-6-acetyl-2-[1-[2-(3,4-dimethoxyphenyl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 110207391 |
| Molecular Formula | C28H29NO8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (2E)-6-acetyl-2-[1-[2-(3,4-dimethoxyphenyl)ethylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccc(CCN/C(C)=C2\C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4C3(C)C2=O)cc1OC |
| InChI | InChI=1S/C28H29NO8/c1-13-24(32)22(15(3)30)26-23(25(13)33)28(4)20(37-26)12-17(31)21(27(28)34)14(2)29-10-9-16-7-8-18(35-5)19(11-16)36-6/h7-8,11-12,29,32-33H,9-10H2,1-6H3/b21-14+ |
| InChIKey | NCCIHORTWJVOQX-KGENOOAVSA-N |
| XLogP | 3.42 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|