C29H31NO7 — CID 90984483
(9aS)-8-acetyl-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxo-N-[(2,3,4,5,6-pentamethylphenyl)methyl]dibenzofuran-4-carboxamide (PubChem CID 90984483) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is (9aS)-8-acetyl-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxo-N-[(2,3,4,5,6-pentamethylphenyl)methyl]dibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxo-N-[(2,3,4,5,6-pentamethylphenyl)methyl]dibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 90984483 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | (9aS)-8-acetyl-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxo-N-[(2,3,4,5,6-pentamethylphenyl)methyl]dibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1c(C)c(C)c(C)c(C)c1C)OC1=CC(=O)C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C29H31NO7/c1-12-13(2)15(4)18(16(5)14(12)3)11-30-28(35)24-21(36-8)9-20(33)25-26(24)37-22-10-19(32)23(17(6)31)27(34)29(22,25)7/h9-10,23,33H,11H2,1-8H3,(H,30,35)/t23?,29-/m1/s1 |
| InChIKey | UCBVKXLEXVFSPO-GJQLDDCUSA-N |
| XLogP | 3.76 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|