C22H19NO8 — CID 91937093
(9aS)-8-acetyl-N-(furan-3-ylmethyl)-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide (PubChem CID 91937093) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is (9aS)-8-acetyl-N-(furan-3-ylmethyl)-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-N-(furan-3-ylmethyl)-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 91937093 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (9aS)-8-acetyl-N-(furan-3-ylmethyl)-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1ccoc1)OC1=CC(=O)C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C22H19NO8/c1-10(24)16-12(25)7-15-22(2,20(16)27)18-13(26)6-14(29-3)17(19(18)31-15)21(28)23-8-11-4-5-30-9-11/h4-7,9,16,26H,8H2,1-3H3,(H,23,28)/t16?,22-/m1/s1 |
| InChIKey | WHSFRVJGLYSTGR-VXNXSFHZSA-N |
| XLogP | 1.81 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|