C28H22BrNO7 — CID 91051266
(9aS)-8-acetyl-N-[(4-bromonaphthalen-1-yl)methyl]-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide (PubChem CID 91051266) has the molecular formula C28H22BrNO7 and a molecular weight of 564.39 g/mol. Its IUPAC name is (9aS)-8-acetyl-N-[(4-bromonaphthalen-1-yl)methyl]-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-N-[(4-bromonaphthalen-1-yl)methyl]-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 91051266 |
| Molecular Formula | C28H22BrNO7 |
| Molecular Weight | 564.39 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | (9aS)-8-acetyl-N-[(4-bromonaphthalen-1-yl)methyl]-1-hydroxy-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1ccc(Br)c3ccccc13)OC1=CC(=O)C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C28H22BrNO7/c1-13(31)22-18(32)11-21-28(2,26(22)34)24-19(33)10-20(36-3)23(25(24)37-21)27(35)30-12-14-8-9-17(29)16-7-5-4-6-15(14)16/h4-11,22,33H,12H2,1-3H3,(H,30,35)/t22?,28-/m1/s1 |
| InChIKey | NGHVUMPPSLUPSH-AALRHGRASA-N |
| XLogP | 4.14 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|