C28H23NO8 — CID 91272974
(9aS)-8-acetyl-1-hydroxy-N-[(2-hydroxynaphthalen-1-yl)methyl]-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide (PubChem CID 91272974) has the molecular formula C28H23NO8 and a molecular weight of 501.49 g/mol. Its IUPAC name is (9aS)-8-acetyl-1-hydroxy-N-[(2-hydroxynaphthalen-1-yl)methyl]-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-1-hydroxy-N-[(2-hydroxynaphthalen-1-yl)methyl]-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 91272974 |
| Molecular Formula | C28H23NO8 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (9aS)-8-acetyl-1-hydroxy-N-[(2-hydroxynaphthalen-1-yl)methyl]-3-methoxy-9a-methyl-7,9-dioxodibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1c(O)ccc3ccccc13)OC1=CC(=O)C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C28H23NO8/c1-13(30)22-18(32)11-21-28(2,26(22)34)24-19(33)10-20(36-3)23(25(24)37-21)27(35)29-12-16-15-7-5-4-6-14(15)8-9-17(16)31/h4-11,22,31,33H,12H2,1-3H3,(H,29,35)/t22?,28-/m1/s1 |
| InChIKey | GYVNEEJQPVIDGF-AALRHGRASA-N |
| XLogP | 3.08 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|