C33H32N2O7 — CID 87502299
(8E,9aS)-8-[1-(cyclopropylmethoxyamino)ethylidene]-1-hydroxy-3-methoxy-9a-methyl-N-[(2-methylnaphthalen-1-yl)methyl]-7,9-dioxodibenzofuran-4-carboxamide (PubChem CID 87502299) has the molecular formula C33H32N2O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is (8E,9aS)-8-[1-(cyclopropylmethoxyamino)ethylidene]-1-hydroxy-3-methoxy-9a-methyl-N-[(2-methylnaphthalen-1-yl)methyl]-7,9-dioxodibenzofuran-4-carboxamide.
| Compound Name | (8E,9aS)-8-[1-(cyclopropylmethoxyamino)ethylidene]-1-hydroxy-3-methoxy-9a-methyl-N-[(2-methylnaphthalen-1-yl)methyl]-7,9-dioxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 87502299 |
| Molecular Formula | C33H32N2O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (8E,9aS)-8-[1-(cyclopropylmethoxyamino)ethylidene]-1-hydroxy-3-methoxy-9a-methyl-N-[(2-methylnaphthalen-1-yl)methyl]-7,9-dioxodibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1c(C)ccc3ccccc13)OC1=CC(=O)/C(=C(/C)NOCC3CC3)C(=O)[C@]12C |
| InChI | InChI=1S/C33H32N2O7/c1-17-9-12-20-7-5-6-8-21(20)22(17)15-34-32(39)28-25(40-4)13-24(37)29-30(28)42-26-14-23(36)27(31(38)33(26,29)3)18(2)35-41-16-19-10-11-19/h5-9,12-14,19,35,37H,10-11,15-16H2,1-4H3,(H,34,39)/b27-18+/t33-/m1/s1 |
| InChIKey | YANLKZVBHMKHNB-SECQYBASSA-N |
| XLogP | 4.68 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|