C24H16F5NO7 — CID 87502533
(9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,3,4,5,6-pentafluorophenyl)methyl]dibenzofuran-4-carboxamide (PubChem CID 87502533) has the molecular formula C24H16F5NO7 and a molecular weight of 525.38 g/mol. Its IUPAC name is (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,3,4,5,6-pentafluorophenyl)methyl]dibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,3,4,5,6-pentafluorophenyl)methyl]dibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 87502533 |
| Molecular Formula | C24H16F5NO7 |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,3,4,5,6-pentafluorophenyl)methyl]dibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1c(F)c(F)c(F)c(F)c1F)OC1=CC(O)=C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C24H16F5NO7/c1-7(31)13-9(32)5-12-24(2,22(13)34)15-10(33)4-11(36-3)14(21(15)37-12)23(35)30-6-8-16(25)18(27)20(29)19(28)17(8)26/h4-5,32-33H,6H2,1-3H3,(H,30,35)/t24-/m1/s1 |
| InChIKey | TUYNUHQGBICGMY-XMMPIXPASA-N |
| XLogP | 3.54 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|