C24H18F3NO7 — CID 86627117
(9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,4,6-trifluorophenyl)methyl]dibenzofuran-4-carboxamide (PubChem CID 86627117) has the molecular formula C24H18F3NO7 and a molecular weight of 489.40 g/mol. Its IUPAC name is (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,4,6-trifluorophenyl)methyl]dibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,4,6-trifluorophenyl)methyl]dibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 86627117 |
| Molecular Formula | C24H18F3NO7 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxo-N-[(2,4,6-trifluorophenyl)methyl]dibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1c(F)cc(F)cc1F)OC1=CC(O)=C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C24H18F3NO7/c1-9(29)18-14(30)7-17-24(2,22(18)32)20-15(31)6-16(34-3)19(21(20)35-17)23(33)28-8-11-12(26)4-10(25)5-13(11)27/h4-7,30-31H,8H2,1-3H3,(H,28,33)/t24-/m1/s1 |
| InChIKey | JUNNIAUCGYYYFX-XMMPIXPASA-N |
| XLogP | 3.27 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|