C25H23NO8 — CID 86627085
(9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-N-[(2-methoxyphenyl)methyl]-9a-methyl-9-oxodibenzofuran-4-carboxamide (PubChem CID 86627085) has the molecular formula C25H23NO8 and a molecular weight of 465.46 g/mol. Its IUPAC name is (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-N-[(2-methoxyphenyl)methyl]-9a-methyl-9-oxodibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-N-[(2-methoxyphenyl)methyl]-9a-methyl-9-oxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 86627085 |
| Molecular Formula | C25H23NO8 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (9aS)-8-acetyl-1,7-dihydroxy-3-methoxy-N-[(2-methoxyphenyl)methyl]-9a-methyl-9-oxodibenzofuran-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1c(OC)cc(O)c2c1OC1=CC(O)=C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C25H23NO8/c1-12(27)19-14(28)10-18-25(2,23(19)30)21-15(29)9-17(33-4)20(22(21)34-18)24(31)26-11-13-7-5-6-8-16(13)32-3/h5-10,28-29H,11H2,1-4H3,(H,26,31)/t25-/m1/s1 |
| InChIKey | DELCPSCXLFFXHR-RUZDIDTESA-N |
| XLogP | 2.86 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|