C24H19Cl2NO7 — CID 87503163
(9aS)-8-acetyl-N-[(2,6-dichlorophenyl)methyl]-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide (PubChem CID 87503163) has the molecular formula C24H19Cl2NO7 and a molecular weight of 504.32 g/mol. Its IUPAC name is (9aS)-8-acetyl-N-[(2,6-dichlorophenyl)methyl]-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-N-[(2,6-dichlorophenyl)methyl]-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 87503163 |
| Molecular Formula | C24H19Cl2NO7 |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | (9aS)-8-acetyl-N-[(2,6-dichlorophenyl)methyl]-1,7-dihydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(=O)NCc1c(Cl)cccc1Cl)OC1=CC(O)=C(C(C)=O)C(=O)[C@]12C |
| InChI | InChI=1S/C24H19Cl2NO7/c1-10(28)18-14(29)8-17-24(2,22(18)31)20-15(30)7-16(33-3)19(21(20)34-17)23(32)27-9-11-12(25)5-4-6-13(11)26/h4-8,29-30H,9H2,1-3H3,(H,27,32)/t24-/m1/s1 |
| InChIKey | RJZDJQIRLXANAG-XMMPIXPASA-N |
| XLogP | 4.16 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|