C20H21NO7 — CID 90715860
(9aS)-8-acetyl-3-methoxy-9a-methyl-7,9-dioxo-1-propoxydibenzofuran-4-carboxamide (PubChem CID 90715860) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is (9aS)-8-acetyl-3-methoxy-9a-methyl-7,9-dioxo-1-propoxydibenzofuran-4-carboxamide.
| Compound Name | (9aS)-8-acetyl-3-methoxy-9a-methyl-7,9-dioxo-1-propoxydibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 90715860 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (9aS)-8-acetyl-3-methoxy-9a-methyl-7,9-dioxo-1-propoxydibenzofuran-4-carboxamide |
| SMILES | CCCOc1cc(OC)c(C(N)=O)c2c1[C@]1(C)C(=O)C(C(C)=O)C(=O)C=C1O2 |
| InChI | InChI=1S/C20H21NO7/c1-5-6-27-12-8-11(26-4)15(19(21)25)17-16(12)20(3)13(28-17)7-10(23)14(9(2)22)18(20)24/h7-8,14H,5-6H2,1-4H3,(H2,21,25)/t14?,20-/m1/s1 |
| InChIKey | NGSPMAGNJNQTLU-YBMSBYLISA-N |
| XLogP | 1.47 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|