C15H13NO5 — CID 141170758
1-hydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide (PubChem CID 141170758) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-hydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide.
| Compound Name | 1-hydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide |
|---|---|
| PubChem CID | 141170758 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-hydroxy-3-methoxy-9a-methyl-9-oxodibenzofuran-4-carboxamide |
| SMILES | COc1cc(O)c2c(c1C(N)=O)OC1=CC=CC(=O)C12C |
| InChI | InChI=1S/C15H13NO5/c1-15-9(18)4-3-5-10(15)21-13-11(14(16)19)8(20-2)6-7(17)12(13)15/h3-6,17H,1-2H3,(H2,16,19) |
| InChIKey | PEGBIXZQNVPPLC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |