C18H15NaO7 — CID 23688959
sodium 4,8-diacetyl-3-hydroxy-2,9a-dimethyl-7,9-dioxodibenzofuran-1-olate (PubChem CID 23688959) has the molecular formula C18H15NaO7 and a molecular weight of 366.30 g/mol. Its IUPAC name is sodium 4,8-diacetyl-3-hydroxy-2,9a-dimethyl-7,9-dioxodibenzofuran-1-olate.
| Compound Name | sodium 4,8-diacetyl-3-hydroxy-2,9a-dimethyl-7,9-dioxodibenzofuran-1-olate |
|---|---|
| PubChem CID | 23688959 |
| Molecular Formula | C18H15NaO7 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | sodium 4,8-diacetyl-3-hydroxy-2,9a-dimethyl-7,9-dioxodibenzofuran-1-olate |
| SMILES | CC(=O)c1c(O)c(C)c([O-])c2c1OC1=CC(=O)C(C(C)=O)C(=O)C12C.[Na+] |
| InChI | InChI=1S/C18H16O7.Na/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24;/h5,11,22-23H,1-4H3;/q;+1/p-1 |
| InChIKey | MKLQPOLHKMNWKN-UHFFFAOYSA-M |
| XLogP | -2.13 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|