C31H27N3O8 — CID 171138487
5-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-2-methoxy-N-pyridin-3-ylbenzamide (PubChem CID 171138487) has the molecular formula C31H27N3O8 and a molecular weight of 569.57 g/mol. Its IUPAC name is 5-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-2-methoxy-N-pyridin-3-ylbenzamide.
| Compound Name | 5-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-2-methoxy-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 171138487 |
| Molecular Formula | C31H27N3O8 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 5-[1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethylamino]-2-methoxy-N-pyridin-3-ylbenzamide |
| SMILES | COc1ccc(NC(C)=C2C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4[C@@]3(C)C2=O)cc1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C31H27N3O8/c1-14-26(37)24(16(3)35)28-25(27(14)38)31(4)22(42-28)12-20(36)23(29(31)39)15(2)33-17-8-9-21(41-5)19(11-17)30(40)34-18-7-6-10-32-13-18/h6-13,33,37-38H,1-5H3,(H,34,40)/t31-/m0/s1 |
| InChIKey | GZNMRXVPNHYMAZ-HKBQPEDESA-N |
| XLogP | 4.34 |
| TPSA | 164.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|