C29H28N2O8 — CID 124879305
(2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-[(3R)-5-methoxy-2-oxo-1,3-dihydroindol-3-yl]ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 124879305) has the molecular formula C29H28N2O8 and a molecular weight of 532.55 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-[(3R)-5-methoxy-2-oxo-1,3-dihydroindol-3-yl]ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-[(3R)-5-methoxy-2-oxo-1,3-dihydroindol-3-yl]ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 124879305 |
| Molecular Formula | C29H28N2O8 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[2-[(3R)-5-methoxy-2-oxo-1,3-dihydroindol-3-yl]ethylamino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccc2c(c1)[C@@H](CCN/C(C)=C1\C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4[C@@]3(C)C1=O)C(=O)N2 |
| InChI | InChI=1S/C29H28N2O8/c1-12-24(34)22(14(3)32)26-23(25(12)35)29(4)20(39-26)11-19(33)21(27(29)36)13(2)30-9-8-16-17-10-15(38-5)6-7-18(17)31-28(16)37/h6-7,10-11,16,30,34-35H,8-9H2,1-5H3,(H,31,37)/b21-13+/t16-,29+/m1/s1 |
| InChIKey | RRSOMZYJPLJNCY-ZKCSHKSHSA-N |
| XLogP | 3.29 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|