C30H30N4O8 — CID 125122075
(2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-(4-methoxyphenyl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 125122075) has the molecular formula C30H30N4O8 and a molecular weight of 574.59 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-(4-methoxyphenyl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-(4-methoxyphenyl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 125122075 |
| Molecular Formula | C30H30N4O8 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-(4-methoxyphenyl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COCc1nc([C@@H](N/C(C)=C2\C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4[C@@]3(C)C2=O)c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C30H30N4O8/c1-13-25(37)22(15(3)35)27-23(26(13)38)30(4)19(42-27)11-18(36)21(28(30)39)14(2)31-24(16-7-9-17(41-6)10-8-16)29-32-20(12-40-5)33-34-29/h7-11,24,31,37-38H,12H2,1-6H3,(H,32,33,34)/b21-14+/t24-,30-/m0/s1 |
| InChIKey | CRLHPHNFFFRTHA-ANAIWDQCSA-N |
| XLogP | 3.22 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|