C29H28N4O7 — CID 125122232
(2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-(4-methoxyphenyl)-(1-methyl-1,2,4-triazol-3-yl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 125122232) has the molecular formula C29H28N4O7 and a molecular weight of 544.56 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-(4-methoxyphenyl)-(1-methyl-1,2,4-triazol-3-yl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-(4-methoxyphenyl)-(1-methyl-1,2,4-triazol-3-yl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 125122232 |
| Molecular Formula | C29H28N4O7 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (2E,9bR)-6-acetyl-7,9-dihydroxy-2-[1-[[(S)-(4-methoxyphenyl)-(1-methyl-1,2,4-triazol-3-yl)methyl]amino]ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccc([C@H](N/C(C)=C2\C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4[C@@]3(C)C2=O)c2ncn(C)n2)cc1 |
| InChI | InChI=1S/C29H28N4O7/c1-13-24(36)21(15(3)34)26-22(25(13)37)29(4)19(40-26)11-18(35)20(27(29)38)14(2)31-23(28-30-12-33(5)32-28)16-7-9-17(39-6)10-8-16/h7-12,23,31,36-37H,1-6H3/b20-14+/t23-,29-/m0/s1 |
| InChIKey | GJVMVXFVCYMTFL-YFVREMBTSA-N |
| XLogP | 3.08 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|