C26H24N4O6 — CID 163091620
6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 163091620) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 163091620 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NC(C)c3nnc4ccccn34)C(=O)C12C |
| InChI | InChI=1S/C26H24N4O6/c1-11-21(33)19(14(4)31)23-20(22(11)34)26(5)16(36-23)10-15(32)18(24(26)35)12(2)27-13(3)25-29-28-17-8-6-7-9-30(17)25/h6-10,13,27,33-34H,1-5H3 |
| InChIKey | PHFISFDRBPZRKJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|