C31H32N4O6 — CID 171135541
(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[2-phenyl-1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]amino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 171135541) has the molecular formula C31H32N4O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[2-phenyl-1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]amino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[2-phenyl-1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]amino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135541 |
| Molecular Formula | C31H32N4O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[2-phenyl-1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]amino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NC(Cc3ccccc3)c3nc(C(C)C)n[nH]3)C(=O)[C@@]12C |
| InChI | InChI=1S/C31H32N4O6/c1-14(2)29-33-30(35-34-29)19(12-18-10-8-7-9-11-18)32-16(4)22-20(37)13-21-31(6,28(22)40)24-26(39)15(3)25(38)23(17(5)36)27(24)41-21/h7-11,13-14,19,32,38-39H,12H2,1-6H3,(H,33,34,35)/t19?,31-/m0/s1 |
| InChIKey | OBVATQGTDGLPOL-CPHVJDLKSA-N |
| XLogP | 4.38 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|