C24H22N2O9S — CID 163032890
4-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-3-hydroxybenzenesulfonamide (PubChem CID 163032890) has the molecular formula C24H22N2O9S and a molecular weight of 514.51 g/mol. Its IUPAC name is 4-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-3-hydroxybenzenesulfonamide.
| Compound Name | 4-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-3-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 163032890 |
| Molecular Formula | C24H22N2O9S |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-3-hydroxybenzenesulfonamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)Nc3ccc(S(N)(=O)=O)cc3O)C(=O)C12C |
| InChI | InChI=1S/C24H22N2O9S/c1-9-20(30)18(11(3)27)22-19(21(9)31)24(4)16(35-22)8-15(29)17(23(24)32)10(2)26-13-6-5-12(7-14(13)28)36(25,33)34/h5-8,26,28,30-31H,1-4H3,(H2,25,33,34) |
| InChIKey | KSJKCWYNZWNRMH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 193.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|