C27H25N5O6 — CID 163093577
6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-[2-(2H-tetrazol-5-yl)ethyl]anilino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 163093577) has the molecular formula C27H25N5O6 and a molecular weight of 515.53 g/mol. Its IUPAC name is 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-[2-(2H-tetrazol-5-yl)ethyl]anilino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-[2-(2H-tetrazol-5-yl)ethyl]anilino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 163093577 |
| Molecular Formula | C27H25N5O6 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[4-[2-(2H-tetrazol-5-yl)ethyl]anilino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)Nc3ccc(CCc4nn[nH]n4)cc3)C(=O)C12C |
| InChI | InChI=1S/C27H25N5O6/c1-12-23(35)21(14(3)33)25-22(24(12)36)27(4)18(38-25)11-17(34)20(26(27)37)13(2)28-16-8-5-15(6-9-16)7-10-19-29-31-32-30-19/h5-6,8-9,11,28,35-36H,7,10H2,1-4H3,(H,29,30,31,32) |
| InChIKey | HQVYTCQVANIOBS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|