C25H23NO7 — CID 171135570
(9bR)-6-acetyl-7,9-dihydroxy-2-[1-(4-methoxyanilino)ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 171135570) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-2-[1-(4-methoxyanilino)ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-(4-methoxyanilino)ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135570 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-2-[1-(4-methoxyanilino)ethylidene]-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | COc1ccc(NC(C)=C2C(=O)C=C3Oc4c(C(C)=O)c(O)c(C)c(O)c4[C@@]3(C)C2=O)cc1 |
| InChI | InChI=1S/C25H23NO7/c1-11-21(29)19(13(3)27)23-20(22(11)30)25(4)17(33-23)10-16(28)18(24(25)31)12(2)26-14-6-8-15(32-5)9-7-14/h6-10,26,29-30H,1-5H3/t25-/m0/s1 |
| InChIKey | WXFUAJKLUJXFAX-VWLOTQADSA-N |
| XLogP | 3.69 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|